BD8321131
5-Aminoisoindolin-1-one , 98% , 222036-66-0
CAS NO.：222036-66-0
Empirical Formula: C8H8N2O
Molecular Weight: 148.16
MDL number: MFCD10000828
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB165.60 | In Stock |
|
| 1g | RMB329.60 | In Stock |
|
| 5g | RMB993.60 | In Stock |
|
| 25g | RMB4899.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-199 °C(Solv: ethyl acetate (141-78-6)) |
| Boiling point: | 520.0±50.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 15.12±0.20(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C8H8N2O/c9-6-1-2-7-5(3-6)4-10-8(7)11/h1-3H,4,9H2,(H,10,11) |
| InChIKey | RGJCJWXNNDARPQ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(N)C=C2)CN1 |
Description and Uses
5-Aminoisoindolin-1-one is used in the synthesis of a novel potent glycoprotein IIb-IIIa (GP IIb-IIIa) receptor antagonist based on the isoindolone skeleton.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| HS Code | 2933998090 |
