BD8342231
3,5-Difluoroisonicotinic acid , 97% , 903522-29-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB57.60 | In Stock |
|
| 1g | RMB143.20 | In Stock |
|
| 5g | RMB608.80 | In Stock |
|
| 10g | RMB1133.60 | In Stock |
|
| 25g | RMB2739.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 317℃ |
| Density | 1.535 |
| Flash point: | 146℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 1.51±0.10(Predicted) |
| form | solid |
| color | White |
| InChI | InChI=1S/C6H3F2NO2/c7-3-1-9-2-4(8)5(3)6(10)11/h1-2H,(H,10,11) |
| InChIKey | DRWDDFVJHGAJTN-UHFFFAOYSA-N |
| SMILES | C1=NC=C(F)C(C(O)=O)=C1F |
Description and Uses
A di-substituted isonicotinic acid (I821760) used in the preparation of pyridyl-fused lactam derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
