BD8345831
Ethyl 5-bromo-1,3,4-thiadiazole-2-carboxylate , 97% , 1030613-07-0
CAS NO.:1030613-07-0
Empirical Formula: C5H5BrN2O2S
Molecular Weight: 237.07
MDL number: MFCD12165919
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB76.80 | In Stock |
|
| 250mg | RMB107.20 | In Stock |
|
| 1g | RMB323.20 | In Stock |
|
| 5g | RMB1332.80 | In Stock |
|
| 10g | RMB2315.20 | In Stock |
|
| 25g | RMB4640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 305.6±25.0 °C(Predicted) |
| Density | 1.743±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | -4.01±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C5H5BrN2O2S/c1-2-10-4(9)3-7-8-5(6)11-3/h2H2,1H3 |
| InChIKey | KDZLTNORBKZJKE-UHFFFAOYSA-N |
| SMILES | S1C(Br)=NN=C1C(OCC)=O |
Description and Uses
Ethyl 5-?Bromo-?1,?3,?4-?thiadiazole-?2-?carboxylate can be used as reactant/reagent in preparation of hydroxyalkyl thiadiazole derivatives as antibacterials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| HS Code | 2934999090 |







![Ethyl 5-bromopyrazolo[1,5-a]pyridine-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/885276-93-7.gif)