BD8347131
3-Chloro-4-(trifluoromethyl)benzonitrile , 96% , 1092460-79-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.00 | In Stock |
|
| 5g | RMB152.00 | In Stock |
|
| 25g | RMB620.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40° |
| Boiling point: | 226.5±40.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H3ClF3N/c9-7-3-5(4-13)1-2-6(7)8(10,11)12/h1-3H |
| InChIKey | IWZFPSVQIDJRAD-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(F)(F)F)C(Cl)=C1 |
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H311-H302+H332-H315-H319 |
| Precautionary statements | P312-P260-P280 |
| RIDADR | UN3439 |
| HazardClass | 6.1 |
| HS Code | 2926907090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



