BD8349331
2-Fluoro-4-(trifluoromethyl)phenylacetic acid , 98% , 209991-64-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB107.20 | In Stock |
|
| 250mg | RMB181.60 | In Stock |
|
| 1g | RMB629.60 | In Stock |
|
| 5g | RMB2472.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81℃ |
| Boiling point: | 255.7±35.0 °C(Predicted) |
| Density | 1.436±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 3.73±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C9H6F4O2/c10-7-4-6(9(11,12)13)2-1-5(7)3-8(14)15/h1-2,4H,3H2,(H,14,15) |
| InChIKey | LUIOBGWYVHPKRC-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(C(F)(F)F)C=C1F |
Description and Uses
Used in the field of nanoparticles. Used in laboratory as reagent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
