BD8359131
2-Bromo-5-hydroxybenzoic acid , 96% , 58380-11-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB134.40 | In Stock |
|
| 10g | RMB260.80 | In Stock |
|
| 25g | RMB556.80 | In Stock |
|
| 100g | RMB2053.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185 °C (decomp) |
| Boiling point: | 374.5±32.0 °C(Predicted) |
| Density | 1.861±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 2.73±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C7H5BrO3/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | HTCSAMJZDHWTKD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(O)=CC=C1Br |
Description and Uses
2-Bromo-5-Hydroxyphenylboronic Acid serves as a reagent in the synthesis and biological activities of some new dibenzopyranones and dibenzopyrans as estrogen receptor agonists and antagonists in relation to anti-osteoporotic and anti-uterotropic and anti-implantation activities
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| HS Code | 2916310090 |
![6-Bromobenzo[d][1,3]dioxole-5-carboxylicAcid](https://img.chemicalbook.com/CAS/GIF/60546-62-5.gif)
