BD8371131
2,3-Dimethyl-6-nitro-2H-indazole , 97% , 444731-73-1
CAS NO.：444731-73-1
Empirical Formula: C9H9N3O2
Molecular Weight: 191.19
MDL number: MFCD10703326
EINECS: 610-189-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB82.40 | In Stock |
|
| 10g | RMB147.20 | In Stock |
|
| 25g | RMB197.60 | In Stock |
|
| 100g | RMB692.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-186°C |
| Boiling point: | 377.0±22.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -0.55±0.30(Predicted) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C9H9N3O2/c1-6-8-4-3-7(12(13)14)5-9(8)10-11(6)2/h3-5H,1-2H3 |
| InChIKey | JHGRUPGVUMAQQU-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC([N+]([O-])=O)=C2)=C(C)N1C |
Description and Uses
2,3-Dimethyl-6-nitro-2H-indazole is an impurity in the synthesis of Pazopanib (P210925) hydrochloride, an oral angiogenesis inhibitor targeting VEGFR and PDGFR.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405 |
