BD8414231
1-Boc-4-(Aminomethyl)-4-hydroxypiperidine , 95% , 392331-66-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB124.00 | In Stock |
|
| 1g | RMB252.80 | In Stock |
|
| 5g | RMB765.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 341.0±27.0 °C(Predicted) |
| Density | 1.124 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 12.48±0.20(Predicted) |
| form | Solid |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C11H22N2O3/c1-10(2,3)16-9(14)13-6-4-11(15,8-12)5-7-13/h15H,4-8,12H2,1-3H3 |
| InChIKey | XYWCDAFPRBDRER-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(CN)(O)CC1 |
| CAS DataBase Reference | 392331-66-7 |
Description and Uses
4-Aminomethyl-1-Boc-4-hydroxypiperidine can be used in agrochemical, pharmaceutical and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
