BD8455731
5-Chloro-1H-pyrrolo[2,3-c]pyridine , 98% , 131084-55-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB135.20 | In Stock |
|
| 5g | RMB575.20 | In Stock |
|
| 10g | RMB1049.60 | In Stock |
|
| 25g | RMB2528.80 | In Stock |
|
| 100g | RMB9636.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 335.8±22.0 °C(Predicted) |
| Density | 1.425 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 13.75±0.40(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C7H5ClN2/c8-7-3-5-1-2-9-6(5)4-10-7/h1-4,9H |
| InChIKey | XAIYMAHUJMVDHR-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC2C=CNC1=2 |
| CAS DataBase Reference | 131084-55-4 |
Description and Uses
5-Chloro-1H-pyrrolo[2,3-c]pyridine is a versatile building block in chemical synthesis, commonly utilized in the pharmaceutical and agrochemical industries for the production of various biologically active compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P270-P271-P280-P301+P312-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P330-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| HS Code | 2933998090 |

![5-Chloro-1H-pyrrolo[2,3-c]pyridine](https://img.chemicalbook.com/CAS/GIF/131084-55-4.gif)

![6-Chloro-3H-1,2,3-triazolo[4,5-c]pyridine](https://img.chemicalbook.com/CAS/GIF/120641-09-0.gif)

![5-<WBR>Chloro-<WBR>1H-<WBR>pyrrolo[2,3-<WBR>b]<WBR>pyridine-<WBR>3-<WBR>carboxylic acid](https://img.chemicalbook.com/CAS/GIF/1203498-99-0.gif)

