BD8475831
2-Bromo-N-isopropylacetamide , 97% , 75726-96-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB180.00 | In Stock |
|
| 1g | RMB448.80 | In Stock |
|
| 5g | RMB1402.40 | In Stock |
|
| 25g | RMB3220.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-64℃ |
| Boiling point: | 266℃ |
| Density | 1.378 |
| Flash point: | 115℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 13.71±0.46(Predicted) |
| InChI | InChI=1S/C5H10BrNO/c1-4(2)7-5(8)3-6/h4H,3H2,1-2H3,(H,7,8) |
| InChIKey | ZLDCRYWMEQJDGW-UHFFFAOYSA-N |
| SMILES | C(NC(C)C)(=O)CBr |
Description and Uses
2-Bromo-N-isopropylacetamide is a an intermediate of Belumosudil.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
