BD8524131
4-Oxo-cyclohexanecarbonitrile , 98% , 34916-10-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB68.80 | In Stock |
|
| 1g | RMB198.40 | In Stock |
|
| 5g | RMB611.20 | In Stock |
|
| 10g | RMB1111.20 | In Stock |
|
| 25g | RMB2683.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 271℃ |
| Density | 1.05 |
| Flash point: | 118℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C7H9NO/c8-5-6-1-3-7(9)4-2-6/h6H,1-4H2 |
| InChIKey | QIWQJGMBIABGRX-UHFFFAOYSA-N |
| SMILES | C1(C#N)CCC(=O)CC1 |
Description and Uses
4-Cyanocyclohexanone is used to prepare nicotinamides as PDE4 D isoenzymes inhibitors. It is also used as an anthranilic acid replacement in niacin receptor agonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H312-H332-H335-H302 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501 |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




![Ethyl 4-oxo-3,4-dihydrothieno[3,2-d]pyrimidine-2-carboxylate](https://img.chemicalbook.com/CAS/20150408/GIF/319442-19-8.gif)


