BD8548431
(S)-3-Methyl-1-(2-piperidinophenyl)butylamine N-Acetyl-L-glutamate , 95% , 219921-94-5
Synonym(s):
(S)-3-Methyl-1-[2-(1-piperidinyl)phenyl]butylamine N-acetyl-L -glutamate salt
CAS NO.:219921-94-5
Empirical Formula: C23H37N3O5
Molecular Weight: 435.557
MDL number: MFCD09840998
EINECS: 606-883-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB116.00 | In Stock |
|
| 10g | RMB200.80 | In Stock |
|
| 25g | RMB400.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-171°C |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChIKey | YPDMBMNFFPWTOV-NXMISADUSA-N |
| SMILES | [C@H](C1=CC=CC=C1N1CCCCC1)(N)CC(C)C.C(O)(=O)[C@@H](NC(=O)C)CCC(O)=O |&1:0,21,r| |
| LogP | 6 at 20℃ |
| Surface tension | 53mN/m at 1.07g/L and 20℃ |
Description and Uses
Repaglinide EP Impurity C
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39-24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |







