BD8563931
Methyl 6-(3-(adamantan-1-yl)-4-methoxyphenyl)-2-naphthoate , 95% , 106685-41-0
Synonym(s):
Methyl 6-[3-(1-adamantyl)-4-methoxyphenyl]-2-naphthoate
CAS NO.:106685-41-0
Empirical Formula: C29H30O3
Molecular Weight: 426.55
MDL number: MFCD08063923
EINECS: 808-698-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB106.40 | In Stock |
|
| 250mg | RMB159.20 | In Stock |
|
| 1g | RMB397.60 | In Stock |
|
| 5g | RMB1208.00 | In Stock |
|
| 25g | RMB3895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-225°C |
| Boiling point: | 589.6±50.0 °C(Predicted) |
| Density | 1.185±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | solid |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C29H30O3/c1-31-27-8-7-24(14-26(27)29-15-18-9-19(16-29)11-20(10-18)17-29)22-3-4-23-13-25(28(30)32-2)6-5-21(23)12-22/h3-8,12-14,18-20H,9-11,15-17H2,1-2H3 |
| InChIKey | PGXNMQBGOVUZNC-UHFFFAOYSA-N |
| SMILES | O(C)c1c(cc(cc1)c5cc6c(cc(cc6)C(=O)OC)cc5)C32CC4CC(C3)CC(C2)C4 |
Description and Uses
Adapalene intermediate
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HS Code | 2918992090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
| REACH Registrations | Inactive |




