BD8567731
Fmoc-Ser(Trt)-OH , 97% , 111061-56-4
Synonym(s):
Fmoc-O-trityl-L -serine;Fmoc-Ser(Trt)-OH;N-α-Fmoc-O-trityl-L-serine
CAS NO.:111061-56-4
Empirical Formula: C37H31NO5
Molecular Weight: 569.65
MDL number: MFCD00153364
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB60.00 | In Stock |
|
| 10g | RMB104.00 | In Stock |
|
| 25g | RMB223.20 | In Stock |
|
| 100g | RMB750.40 | In Stock |
|
| 500g | RMB3265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-210 °C (dec.) |
| alpha | 8 º (c=1%, DMF) |
| Boiling point: | 750.4±60.0 °C(Predicted) |
| Density | 1.256±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.33±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +8.0±1°, c = 1% in DMF |
| BRN | 5684859 |
| Major Application | peptide synthesis |
| InChIKey | UCARTONYOJORBQ-UMSFTDKQSA-N |
| SMILES | C(O)(=O)[C@H](COC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 111061-56-4(CAS DataBase Reference) |
Description and Uses
peptide synthesis







