BD8578331
4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide , 98% , 119018-29-0
Synonym(s):
4-{2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl}benzenesulfonamide;Glimepiride sulfonamide
CAS NO.:119018-29-0
Empirical Formula: C16H21N3O4S
Molecular Weight: 351.42
MDL number: MFCD02955393
EINECS: 411-850-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB43.20 | In Stock |
|
| 10g | RMB76.00 | In Stock |
|
| 25g | RMB165.60 | In Stock |
|
| 100g | RMB610.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-179?C |
| Density | 1.304 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 10.16±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C16H21N3O4S/c1-3-14-11(2)10-19(15(14)20)16(21)18-9-8-12-4-6-13(7-5-12)24(17,22)23/h4-7H,3,8-10H2,1-2H3,(H,18,21)(H2,17,22,23) |
| InChIKey | AJEMFZRCUKJSES-UHFFFAOYSA-N |
| SMILES | N1(C(NCCC2=CC=C(S(N)(=O)=O)C=C2)=O)CC(C)=C(CC)C1=O |
| CAS DataBase Reference | 119018-29-0(CAS DataBase Reference) |
Description and Uses
4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide (Glimepiride EP Impurity B) is an intermediate for the preparation of Glimepiride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 52/53 |
| Safety Statements | 61 |
| WGK Germany | WGK 1 |
| HS Code | 2935909550 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |

![4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide](https://img.chemicalbook.com/CAS/GIF/119018-29-0.gif)





