BD8581131
2,2'-(5-(Bromomethyl)-1,3-phenylene)bis(2-methylpropanenitrile) , 95% , 120511-84-4
CAS NO.：120511-84-4
Empirical Formula: C15H17BrN2
Molecular Weight: 305.21
MDL number: MFCD07782114
EINECS: 601-717-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.80 | In Stock |
|
| 1g | RMB116.00 | In Stock |
|
| 5g | RMB372.80 | In Stock |
|
| 10g | RMB622.40 | In Stock |
|
| 25g | RMB1244.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100°C |
| Boiling point: | 380.0±37.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C15H17BrN2/c1-14(2,9-17)12-5-11(8-16)6-13(7-12)15(3,4)10-18/h5-7H,8H2,1-4H3 |
| InChIKey | IHXHGCDOJLOZML-UHFFFAOYSA-N |
| SMILES | C1(C(C)(C)C#N)=CC(CBr)=CC(C(C)(C)C#N)=C1 |
| CAS DataBase Reference | 120511-84-4(CAS DataBase Reference) |
Description and Uses
α,α,α’,α’-Tetramethyl-5-bromomethyl-1,3-benzenediacetonitrile (Anastrozole EP Impurity C) is an impurity of Anastrozole (A637425) (impurity D).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P312-P330-P363-P403-P501c |
