BD8581331
(6R,7R)-7-Amino-8-oxo-3-(prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid , 95% , 120709-09-3
CAS NO.:120709-09-3
Empirical Formula: C10H12N2O3S
Molecular Weight: 240.28
MDL number: MFCD08458212
EINECS: 601-733-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB97.60 | In Stock |
|
| 25g | RMB332.80 | In Stock |
|
| 100g | RMB1097.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 539.3±50.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated, Sonicated) |
| pka | 2.84±0.50(Predicted) |
| InChI | InChI=1S/C10H12N2O3S/c1-2-3-5-4-16-9-6(11)8(13)12(9)7(5)10(14)15/h2-3,6,9H,4,11H2,1H3,(H,14,15)/t6-,9-/m1/s1 |
| InChIKey | ZYLDQHILNOZKIF-HZGVNTEJSA-N |
| SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(C=CC)=C2C(O)=O |
| CAS DataBase Reference | 120709-09-3(CAS DataBase Reference) |
Description and Uses
7 APCA is a β-lactam compound, which are synthetic intermediates of therapeutically useful β-lactam antibiotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |

![(6R,7R)-7-Amino-8-oxo-3-(prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/120709-09-3.gif)




