BD8588731
4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid , 97% , 127892-62-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5g | RMB78.40 | In Stock |
|
| 10g | RMB98.40 | In Stock |
|
| 25g | RMB239.20 | In Stock |
|
| 100g | RMB927.20 | In Stock |
|
| 500g | RMB3656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164 °C |
| Boiling point: | 339.5±42.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly) |
| pka | 1.90±0.38(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C7H9ClN2O2/c1-3-4-5(8)6(7(11)12)10(2)9-4/h3H2,1-2H3,(H,11,12) |
| InChIKey | NXAIFVHVBHMNJS-UHFFFAOYSA-N |
| SMILES | N1(C)C(C(O)=O)=C(Cl)C(CC)=N1 |
Description and Uses
4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-formic Acid is a useful reagent for the synthesis of anti-microbial compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933.19.9000 |
