BD8593231
(2R,3S)-3-Phenylisoserine hydrochloride , 97% , 132201-32-2
CAS NO.:132201-32-2
Empirical Formula: C9H12ClNO3
Molecular Weight: 217.65
MDL number: MFCD09750971
EINECS: 603-555-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1g | RMB48.80 | In Stock |
|
| 5g | RMB182.40 | In Stock |
|
| 10g | RMB332.80 | In Stock |
|
| 25g | RMB808.80 | In Stock |
|
| 100g | RMB2698.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-224°C (dec.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| color | White |
| InChI | InChI=1/C9H11NO3.ClH/c10-7(8(11)9(12)13)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H/t7-,8+;/s3 |
| InChIKey | OTJZSGZNPDLQAJ-GIFZIGMNNA-N |
| SMILES | [C@@H](O)([C@@H](N)C1C=CC=CC=1)C(O)=O.Cl |&1:0,2,r| |
| CAS DataBase Reference | 132201-32-2(CAS DataBase Reference) |
Description and Uses
(2R,3S)-3-Phenylisoserine Hydrochloride is used in the synthetic preparation of the catalytic asymmetric synthesis of both syn- and anti-β-amino alcohols. (2R,3S)-3-Phenylisoserine Hydrochloride is also used for the synthesis of N-benzoylphenylisoserinates of Lactarius sesquiterpenoid alcohols and is responsible for their antifeedant properties against storage pests.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P301+P312 |
| HS Code | 2922500090 |






