BD8617131
                    (1S,2S,3S,5S)-3-(Benzyloxy)-5-(6-(benzyloxy)-2-(((4-methoxyphenyl)diphenylmethyl)amino)-9H-purin-9-yl)-2-((benzyloxy)methyl)cyclopentanol , 95% , 142217-78-5
CAS NO.:142217-78-5
Empirical Formula: C52H49N5O5
Molecular Weight: 823.98
MDL number: MFCD09750978
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB120.80 | In Stock | 
                                                 | 
                                        
| 5g | RMB422.40 | In Stock | 
                                                 | 
                                        
| 25g | RMB1476.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | >87°C (dec.) | 
                                    
| Density | 1.23 | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Acetonitrile (Slightly, Sonicated), DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) | 
                                    
| pka | 13.87±0.70(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White to Off-White | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChIKey | ZLWZEFPIJWNPCO-ABKHIKNWSA-N | 
                                    
| SMILES | [C@@H]1(O)[C@@H](N2C3C(N=C2)=C(OCC2=CC=CC=C2)N=C(NC(C2=CC=C(OC)C=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=3)C[C@H](OCC2=CC=CC=C2)[C@H]1COCC1=CC=CC=C1 | 
                                    
| CAS DataBase Reference | 142217-78-5(CAS DataBase Reference) | 
                                    
Description and Uses
Entecavir-?5 is used in the preparation of the anti-?HBV drug Entecavir.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 | 





![(1R,2S)-2-[(Phenylmethoxy)methyl]-3-cyclopenten-1-ol](https://img.chemicalbook.com/CAS/GIF/188399-48-6.gif)
![2-AMino-1,9-dihydro-9-[(1S,3R,4S)-4-(hydroxydiMethylsilyl)-3-(hydroxyMethyl)-2-Methylenecyclopentyl]-6H-purin-6-one](https://img.chemicalbook.com/CAS/GIF/870614-82-7.gif)
