BD8622947
5-(Chloromethyl)-2-fluoropyridine , 98% , 315180-15-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB156.00 | In Stock |
|
| 1g | RMB389.60 | In Stock |
|
| 5g | RMB1436.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 227.0±25.0 °C(Predicted) |
| Density | 1.270±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -1.20±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C6H5ClFN/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,3H2 |
| InChIKey | QRXZNFSVRLDKPE-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(CCl)C=C1 |
Description and Uses
5-(Chloromethyl)-2-fluoropyridine is a derivative of Pyridine (P991280), a basic six-membered heterocyclic ring. Pyridine is a base structure present in many biologically active compounds like the vitamins niacin and pyridoxal.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| HS Code | 2933399990 |
