BD8627831
N-Cbz-L-histidine , 98% , 14997-58-1
Synonym(s):
Nα-Carbobenzyloxy-L -histidine;Nα-Z-L -Histidine
CAS NO.:14997-58-1
Empirical Formula: C14H15N3O4
Molecular Weight: 289.29
MDL number: MFCD00065960
EINECS: 239-084-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB160.80 | In Stock |
|
| 25g | RMB621.60 | In Stock |
|
| 100g | RMB2443.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168 °C (dec.)(lit.) |
| alpha | -24 º (c=1 in 6 M HCl) |
| Boiling point: | 616.7±55.0 °C(Predicted) |
| Density | 1.368±0.06 g/cm3(Predicted) |
| refractive index | -23.5 ° (C=6, 6mol/L HCl) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.35±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 24°, c = 1% in 6 M HCl |
| Water Solubility | almost transparency |
| BRN | 3561682 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H15N3O4/c18-13(19)12(6-11-7-15-9-16-11)17-14(20)21-8-10-4-2-1-3-5-10/h1-5,7,9,12H,6,8H2,(H,15,16)(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | WCOJOHPAKJFUDF-LBPRGKRZSA-N |
| SMILES | OC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference | 14997-58-1(CAS DataBase Reference) |
Description and Uses
Nα-Cbz-L-histidine is an N-Cbz-protected form of L-Histidine (H456010). L-Histidine is an essential amino acid that plays an important role in mitochondrial glutamine transport and has potential of abolishing oxidative stress caused by brain edema.L-Histidine promotes zinc uptake in human erythrocyes and also has potential as an antioxidant therapy for acute mammary inflammation in cattle.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |






