PRODUCT Properties
| Boiling point: | 157-159 °C/20 mmHg (lit.) |
| Density | 1.445 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Dark Yellow |
| Specific Gravity | 1.4451.46 |
| InChI | InChI=1S/C9H9BrO2/c10-6-7-12-9(11)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | KNBBDZULQFKSIE-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C1=CC=CC=C1)CBr |
| CAS DataBase Reference | 939-54-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid 2-bromoethyl ester(939-54-8) |
Description and Uses
2-Bromoethyl benzoate may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29163100 |
