BD8630931
tert-Butyl (4R-cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-acetate , 97% , 154026-95-6
CAS NO.:154026-95-6
Empirical Formula: C15H26O6
Molecular Weight: 302.36
MDL number: MFCD08458213
EINECS: 688-142-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25g | RMB132.80 | In Stock |
|
| 100g | RMB387.20 | In Stock |
|
| 500g | RMB1909.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 353.1±22.0 °C(Predicted) |
| Density | 1.036±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C15H26O6/c1-10(16)18-9-12-7-11(19-15(5,6)20-12)8-13(17)21-14(2,3)4/h11-12H,7-9H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | NGABCYSYENPREI-RYUDHWBXSA-N |
| SMILES | C(OC(C)(C)C)(=O)C[C@@H]1C[C@@H](COC(=O)C)OC(O1)(C)C |
| CAS DataBase Reference | 154026-95-6(CAS DataBase Reference) |
Description and Uses
Tert-butyl 2-[(4R,6S)-2,2-Dimethyl-6-[(methylcarbonyloxy)methyl]-1,3-dioxan-4-yl]acetate (Rosuvastatin Impurity 19) is an impurity of Rosuvastatin (R700500), a selective and competitive HMG-CoA reductase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |

![tert-Butyl (4R-cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-acetate](https://img.chemicalbook.com/CAS/GIF/154026-95-6.gif)





