BD8631555
4-Methylbenzenesulfonylcyanide , 99%Tech , 19158-51-1
Synonym(s):
p-Tolylsulfonyl cyanide;Tosyl cyanide
CAS NO.:19158-51-1
Empirical Formula: C8H7NO2S
Molecular Weight: 181.21
MDL number: MFCD00009977
EINECS: 242-849-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB211.20 | In Stock |
|
| 25g | RMB941.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-50 °C (lit.) |
| Boiling point: | 105-106 °C/1 mmHg (lit.) |
| Density | 1.3055 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Sparingly), Ethyl Acetate |
| form | crystalline solid |
| color | White |
| BRN | 2048159 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C8H7NO2S/c1-7-2-4-8(5-3-7)12(10,11)6-9/h2-5H,1H3 |
| InChIKey | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| SMILES | C1(S(C#N)(=O)=O)=CC=C(C)C=C1 |
| CAS DataBase Reference | 19158-51-1(CAS DataBase Reference) |
Description and Uses
p-Toluenesulfonyl cyanide can be used in:
- The preparation of polyfunctional nitriles.
- Free-radical cyanation of B-alkylcatecholboranes.
- The synthesis of 4-hyroxypyridines by hetero-Diels-Alder reaction with 1,3-bis-silyl enol ethers.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H312+H332-H314 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 20/21-34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






