BD8633431
3-Bromo-5-nitropyridin-2-amine , 97% , 15862-31-4
CAS NO.：15862-31-4
Empirical Formula: C5H4BrN3O2
Molecular Weight: 218.01
MDL number: MFCD00955628
EINECS: 689-323-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB16.00 | In Stock |
|
| 5g | RMB22.40 | In Stock |
|
| 10g | RMB40.80 | In Stock |
|
| 25g | RMB88.00 | In Stock |
|
| 100g | RMB346.40 | In Stock |
|
| 500g | RMB1561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-219 °C |
| Boiling point: | 347.3±37.0 °C(Predicted) |
| Density | 1.9128 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 0.06±0.49(Predicted) |
| color | Beige to orange-brown |
| InChI | InChI=1S/C5H4BrN3O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H,(H2,7,8) |
| InChIKey | OFXNHXMPRZDIDM-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C([N+]([O-])=O)C=C1Br |
| CAS DataBase Reference | 15862-31-4(CAS DataBase Reference) |
Description and Uses
2-Amino-3-bromo-5-nitropyridine is a useful intermediate for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
