BD8637331
5-(4-Chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxylic acid , 95% , 162758-35-2
CAS NO.：162758-35-2
Empirical Formula: C17H11Cl3N2O2
Molecular Weight: 381.64
MDL number: MFCD06411080
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB97.60 | In Stock |
|
| 5g | RMB300.80 | In Stock |
|
| 10g | RMB479.20 | In Stock |
|
| 25g | RMB912.80 | In Stock |
|
| 100g | RMB2288.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-203 °C |
| Boiling point: | 551.2±50.0 °C(Predicted) |
| Density | 1.48 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 3.33±0.34(Predicted) |
| color | White |
| InChI | InChI=1S/C17H11Cl3N2O2/c1-9-15(17(23)24)21-22(14-7-6-12(19)8-13(14)20)16(9)10-2-4-11(18)5-3-10/h2-8H,1H3,(H,23,24) |
| InChIKey | CYAYCOCJAVHQSD-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C(Cl)C=C2Cl)C(C2=CC=C(Cl)C=C2)=C(C)C(C(O)=O)=N1 |
| CAS DataBase Reference | 162758-35-2(CAS DataBase Reference) |
Description and Uses
5-(4-Chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxylic Acid is used in the preparation of biarylpyrazole based derivatives as cannabinoid CB1 receptor antagonists. It is metabolite M9 of Rimonabant (R517800), an antiobesity agent.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H314 |
| Precautionary statements | P264b-P271-P280-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501c |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 29339900 |
