![(3R,5S,8AR)-3-phenylhexahydro-2H-oxazolo[3,2-a]pyridine-5-carbonitrile](https://img.chemicalbook.com/CAS/GIF/88056-92-2.gif)
BD8646247
(3R,5S,8AR)-3-phenylhexahydro-2H-oxazolo[3,2-a]pyridine-5-carbonitrile , 95+% , 88056-92-2
Synonym(s):
(−)-2-Cyano-6-phenyloxazolopiperidine;[3R-(3α,5β,8aβ)]-Hexahydro-3-phenyl-5H-oxazolo[3,2-a]pyridin-5-carbonitrile
| Pack Size | Price | Stock | Quantity |
| 1g | RMB742.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82 °C |
| Boiling point: | 370.1°C (rough estimate) |
| Density | 1.18 |
| refractive index | -285 ° (C=1, CHCl3) |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.24±0.60(Predicted) |
| color | White to Almost white |
| InChI | 1S/C14H16N2O/c15-9-12-7-4-8-14-16(12)13(10-17-14)11-5-2-1-3-6-11/h1-3,5-6,12-14H,4,7-8,10H2/t12-,13-,14+/m0/s1 |
| InChIKey | GQHMNZGZXHZLEN-MELADBBJSA-N |
| SMILES | [H][C@@]12CCC[C@@H](C#N)N1[C@@H](CO2)c3ccccc3 |
| CAS DataBase Reference | 88056-92-2 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 2 |
| HS Code | 2934.99.4400 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
