![Fmoc-Thr[PO(OBzl)OH]-OH](https://img.chemicalbook.com/CAS/GIF/175291-56-2.gif)
BD8651631
Fmoc-Thr[PO(OBzl)OH]-OH , 97% , 175291-56-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB156.00 | In Stock |
|
| 250mg | RMB243.20 | In Stock |
|
| 1g | RMB607.20 | In Stock |
|
| 5g | RMB1756.80 | In Stock |
|
| 10g | RMB2930.40 | In Stock |
|
| 25g | RMB5860.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.377±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 1.42±0.50(Predicted) |
| color | White to off-white |
| Sensitive | Moisture Sensitive |
| InChIKey | HOFDVXHILSPFNS-OSPHWJPCSA-N |
| SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)N[C@H](C(O)=O)[C@@H](C)OP(=O)(O)OCC1=CC=CC=C1 |
| CAS DataBase Reference | 175291-56-2(CAS DataBase Reference) |
Description and Uses
Building block for the synthesis of phosphothreonine containing peptides. T.Wakamiya et al., Chem. Lett. , 1994, 1099 T.Vorherr and W.Bannwarth, Bioorg. Med. Chem. Lett 5, 2661 (1995)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| WGK Germany | 3 |
| F | 10-21 |
