BD8654231
5-(Methoxycarbonyl)picolinic acid , 97% , 17874-79-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB42.40 | In Stock |
|
| 5g | RMB127.20 | In Stock |
|
| 10g | RMB240.80 | In Stock |
|
| 25g | RMB560.00 | In Stock |
|
| 100g | RMB2156.00 | In Stock |
|
| 500g | RMB9917.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187 °C |
| Boiling point: | 347.9±27.0 °C(Predicted) |
| Density | 1.361±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly, Heated), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.21±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H7NO4/c1-13-8(12)5-2-3-6(7(10)11)9-4-5/h2-4H,1H3,(H,10,11) |
| InChIKey | NTCKZTBRFXTYBD-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(C(OC)=O)C=C1 |
| CAS DataBase Reference | 17874-79-2(CAS DataBase Reference) |
Description and Uses
Compound has been shown to have insulin mimetic properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P301+P312 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-22 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
