BD8658531
(4-Morpholinophenyl)boronic acid , 98% , 186498-02-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1g | RMB81.60 | In Stock |
|
| 5g | RMB394.40 | In Stock |
|
| 10g | RMB732.80 | In Stock |
|
| 25g | RMB1753.60 | In Stock |
|
| 100g | RMB5869.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126 °C |
| Boiling point: | 425.9±55.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder |
| pka | 9.26±0.17(Predicted) |
| color | Grey |
| InChI | InChI=1S/C10H14BNO3/c13-11(14)9-1-3-10(4-2-9)12-5-7-15-8-6-12/h1-4,13-14H,5-8H2 |
| InChIKey | WHDIUBHAKZDSJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(N2CCOCC2)C=C1)(O)O |
| CAS DataBase Reference | 186498-02-2(CAS DataBase Reference) |
Description and Uses
4-Morpholinophenylboronic Acid is a useful research chemical for the preparation of biologically and pharmacologically active molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Harmful |
| HS Code | 2934999090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral |
