BD8663747
2-Ethylhexylpalmitate , 98% , 29806-73-3
CAS NO.:29806-73-3
Empirical Formula: C24H48O2
Molecular Weight: 368.64
MDL number: MFCD00072255
EINECS: 249-862-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB84.80 | In Stock |
|
| 25g | RMB278.40 | In Stock |
|
| 100g | RMB440.00 | In Stock |
|
| 500g | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2 °C |
| Boiling point: | 398.93°C (rough estimate) |
| Density | 0.8789 (rough estimate) |
| refractive index | 1.4463 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Hexanes (Slightly) |
| form | Solid |
| color | Off-White |
| Specific Gravity | 0.86 |
| Water Solubility | 4.13ng/L at 25℃ |
| Cosmetics Ingredients Functions | PERFUMING SKIN CONDITIONING - EMOLLIENT |
| Cosmetic Ingredient Review (CIR) | Ethylhexyl Palmitate (29806-73-3) |
| InChI | InChI=1S/C24H48O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-21-24(25)26-22-23(6-3)20-8-5-2/h23H,4-22H2,1-3H3 |
| InChIKey | SFAAOBGYWOUHLU-UHFFFAOYSA-N |
| SMILES | C(OCC(CC)CCCC)(=O)CCCCCCCCCCCCCCC |
| LogP | 10.819 (est) |
| CAS DataBase Reference | 29806-73-3 |
| EPA Substance Registry System | 2-Ethylhexyl palmitate (29806-73-3) |
Description and Uses
Octyl Palmitate is used in the making of topical moisturizing and restructuring compositions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| TSCA | TSCA listed |
| Toxicity | LD50 orl-rat: >5 g/kg FCTXAV 19,251,81 |




