BD8682731
2-Amino-4-methylbenzoic acid , 97% , 2305-36-4
CAS NO.：2305-36-4
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00047853
EINECS: 218-976-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB72.80 | In Stock |
|
| 10g | RMB132.80 | In Stock |
|
| 25g | RMB316.00 | In Stock |
|
| 100g | RMB1136.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160 °C |
| Boiling point: | 329.8±30.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.11±0.10(Predicted) |
| color | Off-White to Light Brown |
| InChI | InChI=1S/C8H9NO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | RPGKFFKUTVJVPY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C)C=C1N |
| CAS DataBase Reference | 2305-36-4(CAS DataBase Reference) |
| NIST Chemistry Reference | P-toluic acid, 2-amino-(2305-36-4) |
Description and Uses
2-Amino-4-methylbenzoic Acid performs a herbicidal function in Agriculture. A plant growth-regulator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
