BD8683631
(S)-2-Aminopent-4-ynoic acid hydrochloride , 97% , 198774-27-5
Synonym(s):
(S)-2-Amino-4-pentynoic acid;L -Propargylglycine
CAS NO.:198774-27-5
Empirical Formula: C5H7NO2
Molecular Weight: 113.11
MDL number: MFCD00077855
EINECS: 200-528-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB143.20 | In Stock |
|
| 5g | RMB556.80 | In Stock |
|
| 10g | RMB1075.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265-266 °C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1/C5H7NO2.ClH/c1-2-3-4(6)5(7)8;/h1,4H,3,6H2,(H,7,8);1H/t4-;/s3 |
| InChIKey | UAMBUICGODABQY-NDILARRWNA-N |
| SMILES | [C@@H](N)(C(=O)O)CC#C.Cl |&1:0,r| |
| CAS DataBase Reference | 198774-27-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |




