BD8689031
Methyl 6-bromo-1H-indazole-4-carboxylate , 97% , 885518-49-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB49.60 | In Stock |
|
| 5g | RMB229.60 | In Stock |
|
| 25g | RMB1051.20 | In Stock |
|
| 100g | RMB3994.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 395.9±22.0 °C(Predicted) |
| Density | 1.709±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.21±0.40(Predicted) |
| Appearance | light yellow solid |
| InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)6-2-5(10)3-8-7(6)4-11-12-8/h2-4H,1H3,(H,11,12) |
| InChIKey | FEPRHRPOKPTRQZ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(C(OC)=O)=CC(Br)=C2)C=N1 |
Description and Uses
Methyl 6-bromo-4-indazolecarboxylate is mainly used as an organic synthesis intermediate and is widely used in drug development and chemical research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2933998090 |
