![3,11-Dichloro-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide](https://img.chemicalbook.com/CAS/GIF/26638-66-4.gif)
BD8705931
3,11-Dichloro-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide , 98+% , 26638-66-4
CAS NO.：26638-66-4
Empirical Formula: C14H11Cl2NO2S
Molecular Weight: 328.21
MDL number: MFCD09743977
EINECS: 247-866-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >233oC (dec.) |
| Boiling point: | 445.3±55.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly) |
| form | Solid |
| pka | -4.11±0.40(Predicted) |
| color | White |
| InChI | InChI=1S/C14H11Cl2NO2S/c1-17-12-5-3-2-4-10(12)14(16)11-7-6-9(15)8-13(11)20(17,18)19/h2-8,14H,1H3 |
| InChIKey | FHICZIHQHGRZLE-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)C2=CC(Cl)=CC=C2C(Cl)C2=CC=CC=C2N1C |
Description and Uses
Intermediate in the preparation of Tianeptine and respective metabolites
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P264-P270-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P405-P501 |
