BD8709731
2-Chloro-6-(trifluoromethyl)nicotinic acid , 97% , 280566-45-2
CAS NO.：280566-45-2
Empirical Formula: C7H3ClF3NO2
Molecular Weight: 225.55
MDL number: MFCD01862658
EINECS: 631-076-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB59.20 | In Stock |
|
| 1g | RMB174.40 | In Stock |
|
| 5g | RMB722.40 | In Stock |
|
| 10g | RMB1380.00 | In Stock |
|
| 25g | RMB2481.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120 °C |
| Boiling point: | 271.3±40.0 °C(Predicted) |
| Density | 1.603±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 1.42±0.28(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H3ClF3NO2/c8-5-3(6(13)14)1-2-4(12-5)7(9,10)11/h1-2H,(H,13,14) |
| InChIKey | DXRBTBMFFGEVCX-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C(F)(F)F)=CC=C1C(O)=O |
| CAS DataBase Reference | 280566-45-2(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-trifluoromethylnicotinic acid is used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
