BD8757847
Diethylphenylphosphonite , 98%GC , 1638-86-4
CAS NO.：1638-86-4
Empirical Formula: C10H15O2P
Molecular Weight: 198.2
MDL number: MFCD00009086
EINECS: 216-676-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB57.60 | In Stock |
|
| 25g | RMB200.80 | In Stock |
|
| 100g | RMB662.40 | In Stock |
|
| 500g | RMB2449.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 64°C 0,7mm |
| Density | 1.032 g/mL at 25 °C(lit.) |
| vapor pressure | 47.5Pa at 50℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Sensitive | Air Sensitive |
| BRN | 2804900 |
| InChI | InChI=1S/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | RVDJLKVICMLVJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(P(OCC)OCC)C=C1 |
| LogP | 2.17 at 25℃ |
| CAS DataBase Reference | 1638-86-4 |
| EPA Substance Registry System | Phosphonous acid, phenyl-, diethyl ester (1638-86-4) |
Description and Uses
Diethyl phenylphosphonite is an aromatic compound with catalytic and antibacterial applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29199000 |
