BD8759547
2-Chloro-6-fluoro-3-methylbenzoicacid , 98% , 32890-89-4
CAS NO.：32890-89-4
Empirical Formula: C8H6ClFO2
Molecular Weight: 188.58
MDL number: MFCD01631359
EINECS: 630-021-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB981.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-118°C |
| Boiling point: | 278.1±35.0 °C(Predicted) |
| Density | 1.403±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 2.15±0.25(Predicted) |
| BRN | 2259104 |
| InChI | InChI=1S/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
| InChIKey | VCNCNVOMGXWTBZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=CC(C)=C1Cl |
| CAS DataBase Reference | 32890-89-4(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-fluoro-3-methylbenzoic acid can be used as a drug synthesis intermediate. Literature reports that it can be used to synthesize stearoyl-CoA desaturase 1 (SCD1) inhibitors for the treatment of obesity and other diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
