BD8768147
Methyl4-(butyrylamino)-3-methyl-5-nitrobenzoate , 97% , 152628-01-8
CAS NO.：152628-01-8
Empirical Formula: C13H16N2O5
Molecular Weight: 280.28
MDL number: MFCD08062447
EINECS: 604-865-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1g | RMB104.80 | In Stock |
|
| 5g | RMB366.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 468.1±45.0 °C(Predicted) |
| Density | 1.265 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.27±0.70(Predicted) |
| color | White |
| InChI | InChI=1S/C13H16N2O5/c1-4-5-11(16)14-12-8(2)6-9(13(17)20-3)7-10(12)15(18)19/h6-7H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | IGCBUUTXGYCQAI-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC([N+]([O-])=O)=C(NC(=O)CCC)C(C)=C1 |
| CAS DataBase Reference | 152628-01-8(CAS DataBase Reference) |
Description and Uses
4-Butyrylamino-3-methyl-5-nitrobenzoic Acid Methyl Ester is a useful synthetic intermediate in the production of Telmisartan, an antihypertensive drug. 4-Butyrylamino-3-methyl-5-nitrobenzoic Acid Methyl Ester is part of a more efficient process of synthesizing Telmisartan in terms of impurity, yield, cost, and large-scale production.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
