BD8792631
1-Boc-3-Methylaminopyrrolidine , 97% , 454712-26-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB284.00 | In Stock |
|
| 25g | RMB1355.20 | In Stock |
|
| 100g | RMB4738.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 269 °C |
| Density | 1.03 |
| Flash point: | 117 °C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | solid |
| pka | 10.02±0.20(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | -1.16°(C=0.50g/100mL, CHCL3, 20°C, 589nm) |
| InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-5-8(7-12)11-4/h8,11H,5-7H2,1-4H3 |
| InChIKey | OKUCEQDKBKYEJY-UHFFFAOYSA-N |
| SMILES | CNC1CCN(C1)C(=O)OC(C)(C)C |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P337+P313-P304+P340-P312-P280-P332+P313 |
| Hazard Codes | T,N |
| Risk Statements | 25-50 |
| Safety Statements | 45-61 |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| HazardClass | 8 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




