BD8802031
Ethyl 2,3-dihydrobenzo[1,4]dioxine-2-carboxylate , 95% , 4739-94-0
Synonym(s):
1,4-Benzodioxan-2-carboxylic acid, ethyl ester;Ethyl 2,3-dihydro-1,4-benzodioxin-2-carboxylate
| Pack Size | Price | Stock | Quantity |
| 5g | RMB162.40 | In Stock |
|
| 10g | RMB284.00 | In Stock |
|
| 25g | RMB572.00 | In Stock |
|
| 100g | RMB1995.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 88-95 °C/0.3 mmHg (lit.) |
| Density | 1.208 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C11H12O4/c1-2-13-11(12)10-7-14-8-5-3-4-6-9(8)15-10/h3-6,10H,2,7H2,1H3 |
| InChIKey | DDIGEMWIKJMEIU-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OCC1C(OCC)=O |
| CAS DataBase Reference | 4739-94-0(CAS DataBase Reference) |
Description and Uses
2,3-Dihydro-1,4-benzodioxin-2-carboxylic Acid Ethyl Ester is an intermediate used to prepare presynaptic α2-adrenoreceptor antagonists and potential antidepressants. It is also used to prepare aminoalkylbenzodioxins as calcium antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |

![Ethyl 2,3-dihydrobenzo[1,4]dioxine-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/4739-94-0.gif)





