BD8824631
5-Amino-3-methyl-1,2,4-thiadiazole , 98% , 17467-35-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5g | RMB90.40 | In Stock |
|
| 10g | RMB168.80 | In Stock |
|
| 25g | RMB310.40 | In Stock |
|
| 100g | RMB1030.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202 °C |
| Boiling point: | 261.2±23.0 °C(Predicted) |
| Density | 1.372±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.56±0.50(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C3H5N3S/c1-2-5-3(4)7-6-2/h1H3,(H2,4,5,6) |
| InChIKey | DJKUIGPCSNRFRK-UHFFFAOYSA-N |
| SMILES | S1C(N)=NC(C)=N1 |
| CAS DataBase Reference | 17467-35-5(CAS DataBase Reference) |
Description and Uses
3-methyl-1,2,4-thiadiazol-5-amine is a useful intermediate used in the preparation of 1,2,4-thiadiazole analogue that functions as a non-peptide inhibitor of beta-secretase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
