BD8832131
2,4-Dichloropyrimidine-5-carbaldehyde , 98% , 871254-61-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB86.40 | In Stock |
|
| 250mg | RMB108.00 | In Stock |
|
| 1g | RMB282.40 | In Stock |
|
| 5g | RMB876.00 | In Stock |
|
| 25g | RMB3504.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 294.0±20.0 °C(Predicted) |
| Density | 1.588±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -4.44±0.29(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C5H2Cl2N2O/c6-4-3(2-10)1-8-5(7)9-4/h1-2H |
| InChIKey | MTIXQNKVUJSOQH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C=O)C(Cl)=N1 |
Description and Uses
2,4-Dichloro-5-pyrimidinecarboxaldehyde, is an organic building block used for the synthesis of novel pyrazolo[3,4-d]pyrimidine compounds, as possible kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933599590 |
