BD8836347
7-Chlorobenzofuran , 96% , 24410-55-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB96.00 | In Stock |
|
| 250mg | RMB163.20 | In Stock |
|
| 1g | RMB408.80 | In Stock |
|
| 5g | RMB1202.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214-216 °C |
| Density | 1.289±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C8H5ClO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H |
| InChIKey | AROWSPBDKGWJNQ-UHFFFAOYSA-N |
| SMILES | O1C2=C(Cl)C=CC=C2C=C1 |
Description and Uses
7-Chlorobenzofuran is a useful organic compound that can be used to synthesize Benzofuran-7-ol[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2932990090 |
