N,N-Dimethyl-2,3-bis((Z)-octadec-9-en-1-yloxy)propan-1-amine , 98% , 104162-47-2
Synonym(s):
N,N-Dimethyl-2,3-bis[(9Z)-9-octadecen-1-yloxy]-1-propanamine;1,2-Dioleyloxy-3-(dimethylamino)propane;1,2-Dioleyloxy-3-dimethylaminopropane;DODMA
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB480.00 | In Stock |
|
| 250mg | RMB752.00 | In Stock |
|
| 1g | RMB2400.00 | In Stock |
|
| 5g | RMB7680.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 649.7±55.0 °C(Predicted) |
| Density | 0.869±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in Ethanol, DMSO, DMF |
| pka | 8.65±0.28(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| biological source | synthetic |
| BRN | 10139013 |
| InChIKey | GLGLUQVVDHRLQK-WRBBJXAJSA-N |
| SMILES | C(N(C)C)C(OCCCCCCCC/C=C\CCCCCCCC)COCCCCCCCC/C=C\CCCCCCCC |
Description and Uses
1,2-Dioleyloxy-3-dimethylamino-propane (DODMA) is a cationic lipid containing the unsaturated long-chain (18:1) oleic acid inserted at both the sn-1 and sn-2 positions. It has been used in the composition of liposomes formulated as stable nucleic acid lipid particles that can encapsulate siRNA or other small molecules to be used for drug delivery.
1,2-Dioleyloxy-3-dimethylamino-propane is a cationic lipid containing the unsaturated long-chain (18:1) oleic acid inserted at both the sn-1 and sn-2 positions. It has been used in the composition of lipospomes formulated as stable nucleic acid lipid particles that can encapsulate siRNA or other small molecules to be used for drug delivery.[Cayman Chemical]
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H331-H336-H351-H361d-H372 |
| Precautionary statements | P201-P260-P264-P280-P304+P340+P311-P403+P233 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |








