BD8843347
Chlorotricyclohexylstannane , 98+% , 3091-32-5
Synonym(s):
Chlorotricyclohexyltin
CAS NO.：3091-32-5
Empirical Formula: C18H33ClSn
Molecular Weight: 403.62
MDL number: MFCD00003817
EINECS: 221-437-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-125 °C (lit.) |
| Boiling point: | >250°C |
| RTECS | WH6830000 |
| Flash point: | >150°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in ethanol, ether, toluene and chloroform. Insoluble in water. |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/3C6H11.ClH.Sn/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;1H;/q;;;;+1/p-1 |
| InChIKey | OJVZYIKTLISAIH-UHFFFAOYSA-M |
| SMILES | Cl[Sn](C1CCCCC1)(C2CCCCC2)C3CCCCC3 |
| CAS DataBase Reference | 3091-32-5 |
| EPA Substance Registry System | Stannane, chlorotricyclohexyl- (3091-32-5) |
Description and Uses
Tricyclohexyltin chloride is used in the preparation of dicyclohexyl disulfide. It is also used in the synthesis of organotin derivatives of 2-thiophene carboxylic acid as enzyme inhibitors and antibacterial agents.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H410 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-50/53 |
| Safety Statements | 26-28-61-60 |
| RIDADR | 3146 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
