BD8847131
4-Methyl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid , 98% , 306960-74-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB432.80 | In Stock |
|
| 5g | RMB1195.20 | In Stock |
|
| 25g | RMB3832.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >210℃ |
| Boiling point: | 237℃ |
| Density | 1.491 |
| Flash point: | 97℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 1.67±0.25(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | 1S/C7H5F3N2O2/c1-3-4(5(13)14)2-11-6(12-3)7(8,9)10/h2H,1H3,(H,13,14) |
| InChIKey | BURXOXYGSJVOBI-UHFFFAOYSA-N |
| SMILES | Cc1nc(ncc1C(O)=O)C(F)(F)F |
Description and Uses
4-Methyl-2-(trifluoromethyl)pyrimidine-5-carboxylic Acid is a useful compound for studying insecticidal anthranilic diamides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







