BD8855347
2,3-Dihydro-1H-inden-4-amine , 98% , 32202-61-2
Synonym(s):
4-Indanamine
CAS NO.：32202-61-2
Empirical Formula: C9H11N
Molecular Weight: 133.19
MDL number: MFCD00082598
EINECS: 250-950-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB76.80 | In Stock |
|
| 5g | RMB377.60 | In Stock |
|
| 25g | RMB1542.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 9℃ |
| Boiling point: | 90-92 °C (lit.) |
| Density | 1.102 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| pka | 4.49±0.20(Predicted) |
| form | liquid |
| color | Yellow (material may darken on storage) |
| InChI | InChI=1S/C9H11N/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6H,1,3,5,10H2 |
| InChIKey | RXTJLDXSGNEJIT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(N)=CC=C2)CC1 |
| CAS DataBase Reference | 32202-61-2 |
Description and Uses
4-Aminoindan was used in the synthesis of 4,5-dihydro-N-(2,3-dihydro-1H-inden-4-yl)oxazol-2-amine and 1-(2-chloroethyl)-3-(2,3-dihydro-1H-inden-4-yl)urea.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921490090 |
