BD8860031
Boc-β-HoPhe-OH , 95% , 51871-62-6
Synonym(s):
(S)-3-(Boc-amino)-4-phenylbutyric acid;Boc-L -β-homophenylalanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB189.60 | In Stock |
|
| 1g | RMB363.20 | In Stock |
|
| 5g | RMB1088.80 | In Stock |
|
| 25g | RMB3811.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-107 °C |
| Boiling point: | 444.8±38.0 °C(Predicted) |
| Density | 1.139 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.43±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 19.0±2°, c = 1% in methylene chloride |
| BRN | 3060457 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(10-13(17)18)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | ACKWQHCPHJQANL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccccc1 |
| CAS DataBase Reference | 51871-62-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
